Products 136174-04-4
CAS 136174-04-4 appears in our catalog under these names: RG-12915, RG-12915, 98.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 10 mg, 5 mg, 25 mg.
N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chloro-5a,6,7,8,9,9a-hexahydrodibenzofuran-4-carboxamide (CAS 136174-04-4) is a chemical compound with the molecular formula C20H25ClN2O2 and a molecular weight of 360.9 g/mol. IUPAC name: N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chloro-5a,6,7,8,9,9a-hexahydrodibenzofuran-4-carboxamide. InChIKey: LDYMIBZOCSHLBG-UHFFFAOYSA-N.
| Molecular formula | C20H25ClN2O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-chloro-5a,6,7,8,9,9a-hexahydrodibenzofuran-4-carboxamide |
| InChIKey | LDYMIBZOCSHLBG-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C3=C(O2)C(=CC(=C3)Cl)C(=O)NC4CN5CCC4CC5 |
Computed by PubChem (NCBI)
Synonyms:
orb1708683, orb1738357