Products 1300030-83-4
CAS 1300030-83-4 is the registry number for N-Benzyl-2-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-2-oxoacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-benzyl-2-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-2-oxoacetamide (CAS 1300030-83-4) is a chemical compound with the molecular formula C18H17N3O2 and a molecular weight of 307.3 g/mol. IUPAC name: N-benzyl-2-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-2-oxoacetamide. InChIKey: UNEYHKFKMBJCEF-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | N-benzyl-2-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-2-oxoacetamide |
| InChIKey | UNEYHKFKMBJCEF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)C(=O)C(=O)NCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)