Products 36883-36-0
CAS 36883-36-0 appears in our catalog under these names: 2-(Diphenylmethyl)-2,5,7-triazaspiro[3.4]octane-6,8-dione, 95%, 2-Benzhydryl-2,5,7-triazaspiro(3.4)octane-6,8-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-benzhydryl-2,5,7-triazaspiro[3.4]octane-6,8-dione (CAS 36883-36-0) is a chemical compound with the molecular formula C18H17N3O2 and a molecular weight of 307.3 g/mol. IUPAC name: 2-benzhydryl-2,5,7-triazaspiro[3.4]octane-6,8-dione. InChIKey: WKSAPRZVBCMEQA-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-benzhydryl-2,5,7-triazaspiro[3.4]octane-6,8-dione |
| InChIKey | WKSAPRZVBCMEQA-UHFFFAOYSA-N |
| SMILES | C1C2(CN1C(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)