Products 130015-00-8
CAS 130015-00-8 is the registry number for α-Ionone-13C3. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(E)-4-(2,6,6-trimethylcyclohexen-1-yl)(1,2,3-13C3)but-3-en-2-one (CAS 130015-00-8) is a chemical compound with the molecular formula C13H20O and a molecular weight of 195.27 g/mol. IUPAC name: (E)-4-(2,6,6-trimethylcyclohexen-1-yl)(1,2,3-13C3)but-3-en-2-one. InChIKey: PSQYTAPXSHCGMF-SAKRTJKUSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 195.27 g/mol |
| IUPAC name | (E)-4-(2,6,6-trimethylcyclohexen-1-yl)(1,2,3-13C3)but-3-en-2-one |
| InChIKey | PSQYTAPXSHCGMF-SAKRTJKUSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=[13CH]/[13C](=O)[13CH3] |
Computed by PubChem (NCBI)