Products 53163-45-4
CAS 53163-45-4 is the registry number for (E)-β-Ionone-d3, 99.9%. Offered by: MedChemExpress. Available pack sizes: 10 mg.
(E)-1,1,1-trideuterio-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (CAS 53163-45-4) is a chemical compound with the molecular formula C13H20O and a molecular weight of 195.32 g/mol. IUPAC name: (E)-1,1,1-trideuterio-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one. InChIKey: PSQYTAPXSHCGMF-APFIAUBDSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 195.32 g/mol |
| IUPAC name | (E)-1,1,1-trideuterio-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| InChIKey | PSQYTAPXSHCGMF-APFIAUBDSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)/C=C/C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)