CAS 130046-78-5 is the registry number for 1,3-Dibromo-5-fluoro-2-(phenylmethoxy)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
1,3-dibromo-5-fluoro-2-phenylmethoxybenzene (CAS 130046-78-5) is a chemical compound with the molecular formula C13H9Br2FO and a molecular weight of 360.02 g/mol. IUPAC name: 1,3-dibromo-5-fluoro-2-phenylmethoxybenzene. InChIKey: SKHROZAEMJEPPI-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2FO |
|---|---|
| Molecular weight | 360.02 g/mol |
| IUPAC name | 1,3-dibromo-5-fluoro-2-phenylmethoxybenzene |
| InChIKey | SKHROZAEMJEPPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)F)Br |
Computed by PubChem (NCBI)