Products 1610471-01-6

CAS 1610471-01-6 is the registry number for 2-(Benzyloxy)-1,5-dibromo-3-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1,5-dibromo-3-fluoro-2-phenylmethoxybenzene (CAS 1610471-01-6) is a chemical compound with the molecular formula C13H9Br2FO and a molecular weight of 360.02 g/mol. IUPAC name: 1,5-dibromo-3-fluoro-2-phenylmethoxybenzene. InChIKey: HTSISNIBKBBIIP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9Br2FO
Molecular weight360.02 g/mol
IUPAC name1,5-dibromo-3-fluoro-2-phenylmethoxybenzene
InChIKeyHTSISNIBKBBIIP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Br)F

Computed by PubChem (NCBI)