CAS 1300582-62-0 appears in our catalog under these names: 2,3-Dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 98+%, 2,3-Dimethyl-2H-indazole-6-boronic acid, pinacol ester, 97%, 97%, 2,3-DIMETHYL-2H-INDAZOLE-6-BORONIC ACID PINACOL ESTER, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1300582-62-0) is a chemical compound with the molecular formula C15H21BN2O2 and a molecular weight of 272.15 g/mol. IUPAC name: 2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: LGSHSAUSROENNG-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O2 |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | LGSHSAUSROENNG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NN(C(=C3C=C2)C)C |
Computed by PubChem (NCBI)