CAS 130104-15-3 appears in our catalog under these names: (S)-2'-(Diethylcarbamoyl)-(1,1'-binaphthalene)-2-carboxylic acid, 98%, [1,1′-Binaphthalene]-2-carboxylic acid,2′-[(diethylamino)carbonyl]-,(S)-, 98%, 98%, [1,1′-Binaphthalene]-2-carboxylic acid,2′-[(diethylamino)carbonyl]-,(S)-, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-[2-(diethylcarbamoyl)naphthalen-1-yl]naphthalene-2-carboxylic acid (CAS 130104-15-3) is a chemical compound with the molecular formula C26H23NO3 and a molecular weight of 397.5 g/mol. IUPAC name: 1-[2-(diethylcarbamoyl)naphthalen-1-yl]naphthalene-2-carboxylic acid. InChIKey: SOAHAZRUAHEOJO-UHFFFAOYSA-N.
| Molecular formula | C26H23NO3 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 1-[2-(diethylcarbamoyl)naphthalen-1-yl]naphthalene-2-carboxylic acid |
| InChIKey | SOAHAZRUAHEOJO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)