Products 166977-24-8
CAS 166977-24-8 is the registry number for BMS-185411. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(5,5-dimethyl-8-phenyl-6H-naphthalene-2-carbonyl)amino]benzoic acid (CAS 166977-24-8) is a chemical compound with the molecular formula C26H23NO3 and a molecular weight of 397.5 g/mol. IUPAC name: 4-[(5,5-dimethyl-8-phenyl-6H-naphthalene-2-carbonyl)amino]benzoic acid. InChIKey: AZQWAFBHDUNJHM-UHFFFAOYSA-N.
| Molecular formula | C26H23NO3 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalene-2-carbonyl)amino]benzoic acid |
| InChIKey | AZQWAFBHDUNJHM-UHFFFAOYSA-N |
| SMILES | CC1(CC=C(C2=C1C=CC(=C2)C(=O)NC3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)