CAS 130114-77-1 is the registry number for 1,5-Dideoxy-1,5-imino-D-xylitol. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.
(3S,5R)-piperidine-3,4,5-triol (CAS 130114-77-1) is a chemical compound with the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. IUPAC name: (3S,5R)-piperidine-3,4,5-triol. InChIKey: RMCNETIHECSPMZ-NGQZWQHPSA-N.
| Molecular formula | C5H11NO3 |
|---|---|
| Molecular weight | 133.15 g/mol |
| IUPAC name | (3S,5R)-piperidine-3,4,5-triol |
| InChIKey | RMCNETIHECSPMZ-NGQZWQHPSA-N |
| SMILES | C1[C@H](C([C@H](CN1)O)O)O |
Computed by PubChem (NCBI)