Products 1301204-97-6

CAS 1301204-97-6 is the registry number for Rel-(2R,5R)-5-fluoropiperidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,5R)-5-fluoropiperidine-2-carboxylic acid (CAS 1301204-97-6) is a chemical compound with the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. IUPAC name: (2R,5R)-5-fluoropiperidine-2-carboxylic acid. InChIKey: RHTGVGPUHYZXLP-RFZPGFLSSA-N.

Identity
Molecular formulaC6H10FNO2
Molecular weight147.15 g/mol
IUPAC name(2R,5R)-5-fluoropiperidine-2-carboxylic acid
InChIKeyRHTGVGPUHYZXLP-RFZPGFLSSA-N
SMILESC1C[C@@H](NC[C@@H]1F)C(=O)O

Computed by PubChem (NCBI)