CAS 1301204-97-6 is the registry number for Rel-(2R,5R)-5-fluoropiperidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-5-fluoropiperidine-2-carboxylic acid (CAS 1301204-97-6) is a chemical compound with the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. IUPAC name: (2R,5R)-5-fluoropiperidine-2-carboxylic acid. InChIKey: RHTGVGPUHYZXLP-RFZPGFLSSA-N.
| Molecular formula | C6H10FNO2 |
|---|---|
| Molecular weight | 147.15 g/mol |
| IUPAC name | (2R,5R)-5-fluoropiperidine-2-carboxylic acid |
| InChIKey | RHTGVGPUHYZXLP-RFZPGFLSSA-N |
| SMILES | C1C[C@@H](NC[C@@H]1F)C(=O)O |
Computed by PubChem (NCBI)