Products 130135-97-6

CAS 130135-97-6 is the registry number for 6-((6-(Acryloyloxy)hexyl)oxy)-2-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylic acid (CAS 130135-97-6) is a chemical compound with the molecular formula C20H22O5 and a molecular weight of 342.4 g/mol. IUPAC name: 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylic acid. InChIKey: KRPVBRVKSRUCAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22O5
Molecular weight342.4 g/mol
IUPAC name6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylic acid
InChIKeyKRPVBRVKSRUCAQ-UHFFFAOYSA-N
SMILESC=CC(=O)OCCCCCCOC1=CC2=C(C=C1)C=C(C=C2)C(=O)O

Computed by PubChem (NCBI)