CAS 130148-49-1 is the registry number for 8-Amino-1,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-amino-3H-quinazolin-4-one (CAS 130148-49-1) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 8-amino-3H-quinazolin-4-one. InChIKey: PYVNSJBGHICCFN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 8-amino-3H-quinazolin-4-one |
| InChIKey | PYVNSJBGHICCFN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)N=CNC2=O |
Computed by PubChem (NCBI)