CAS 130190-60-2 appears in our catalog under these names: 2-Benzoyl-5-bromo-1H-pyrrole, Ketorolac Impurity 57. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
(5-bromo-1H-pyrrol-2-yl)-phenylmethanone (CAS 130190-60-2) is a chemical compound with the molecular formula C11H8BrNO and a molecular weight of 250.09 g/mol. IUPAC name: (5-bromo-1H-pyrrol-2-yl)-phenylmethanone. InChIKey: PGGMZYNSGDBCEH-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | (5-bromo-1H-pyrrol-2-yl)-phenylmethanone |
| InChIKey | PGGMZYNSGDBCEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(N2)Br |
Computed by PubChem (NCBI)