CAS 130284-00-3 is the registry number for 2-(Benzyloxy)-3,5-dibromopyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dibromo-2-phenylmethoxypyridine (CAS 130284-00-3) is a chemical compound with the molecular formula C12H9Br2NO and a molecular weight of 343.01 g/mol. IUPAC name: 3,5-dibromo-2-phenylmethoxypyridine. InChIKey: YNNOMHHKXNIXKO-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2NO |
|---|---|
| Molecular weight | 343.01 g/mol |
| IUPAC name | 3,5-dibromo-2-phenylmethoxypyridine |
| InChIKey | YNNOMHHKXNIXKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=N2)Br)Br |
Computed by PubChem (NCBI)