Products 292636-54-5
CAS 292636-54-5 is the registry number for 4-(2,4-Dibromophenoxy)benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2,4-dibromophenoxy)aniline (CAS 292636-54-5) is a chemical compound with the molecular formula C12H9Br2NO and a molecular weight of 343.01 g/mol. IUPAC name: 4-(2,4-dibromophenoxy)aniline. InChIKey: WJQKXOPJPUQOLX-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2NO |
|---|---|
| Molecular weight | 343.01 g/mol |
| IUPAC name | 4-(2,4-dibromophenoxy)aniline |
| InChIKey | WJQKXOPJPUQOLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)