CAS 130304-80-2 appears in our catalog under these names: Fmoc–Asp(OcHex)–OH, Fmoc-L-Asp(OcHx)-OH, Fmoc-Asp(OcHex)-OH 98%, L-Aspartic acid, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 4-cyclohexyl ester, 98%, 98%, Fmoc-Asp(OcHex)-OH, 98.0%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 10 g, 100 g, 25 g.
(2S)-4-cyclohexyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 130304-80-2) is a chemical compound with the molecular formula C25H27NO6 and a molecular weight of 437.5 g/mol. IUPAC name: (2S)-4-cyclohexyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: OCMZRMNYEXIKQI-QFIPXVFZSA-N.
| Molecular formula | C25H27NO6 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (2S)-4-cyclohexyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | OCMZRMNYEXIKQI-QFIPXVFZSA-N |
| SMILES | C1CCC(CC1)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)