CAS 625119-82-6 is the registry number for Fmoc-L-trans-Hyp(THP)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-(oxan-2-yloxy)pyrrolidine-2-carboxylic acid (CAS 625119-82-6) is a chemical compound with the molecular formula C25H27NO6 and a molecular weight of 437.5 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-(oxan-2-yloxy)pyrrolidine-2-carboxylic acid. InChIKey: CBNWACXCGSUTOF-PWRVTVRBSA-N.
| Molecular formula | C25H27NO6 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-(oxan-2-yloxy)pyrrolidine-2-carboxylic acid |
| InChIKey | CBNWACXCGSUTOF-PWRVTVRBSA-N |
| SMILES | C1CCOC(C1)O[C@@H]2C[C@H](N(C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)