CAS 13035-63-7 appears in our catalog under these names: 4–Iodobenzenesulfonic acid, 4-Iodobenzenesulfonic acid 95%, 4-Iodobenzenesulfonic acid, 95%, 95%, 4-Iodobenzenesulfonic acid, 95%(HPLC),RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
Potassium 4-iodobenzenesulfonate (CAS 13035-63-7) is a chemical compound with the molecular formula C6H4IKO3S and a molecular weight of 322.16 g/mol. IUPAC name: potassium 4-iodobenzenesulfonate. InChIKey: JKXILXFUIWOQAP-UHFFFAOYSA-M.
| Molecular formula | C6H4IKO3S |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | potassium 4-iodobenzenesulfonate |
| InChIKey | JKXILXFUIWOQAP-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1S(=O)(=O)[O-])I.[K+] |
Computed by PubChem (NCBI)