CAS 166902-23-4 appears in our catalog under these names: Potassium 4-iodobenzenesulfonate, 95%, Potassium 4-iodobenzenesulfonate, 95%, 95%, Potassium4–iodobenzenesulfonate. Offered by: AmBeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
Potassium 4-iodobenzenesulfonate (CAS 166902-23-4) is a chemical compound with the molecular formula C6H4IKO3S and a molecular weight of 322.16 g/mol. IUPAC name: potassium 4-iodobenzenesulfonate. InChIKey: JKXILXFUIWOQAP-UHFFFAOYSA-M.
| Molecular formula | C6H4IKO3S |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | potassium 4-iodobenzenesulfonate |
| InChIKey | JKXILXFUIWOQAP-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1S(=O)(=O)[O-])I.[K+] |
Computed by PubChem (NCBI)