CAS 1303889-63-5 appears in our catalog under these names: 3-tert-Butyl-4-methyl-1-phenyl-1H-pyrazol-5-amine hydrochloride, 95%, 3-tert-Butyl-4-methyl-1-phenyl-1H-pyrazol-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-tert-butyl-4-methyl-1-phenylpyrazol-5-amine;hydrochloride (CAS 1303889-63-5) is a chemical compound with the molecular formula C14H20ClN3 and a molecular weight of 265.78 g/mol. IUPAC name: 3-tert-butyl-4-methyl-1-phenylpyrazol-5-amine;hydrochloride. InChIKey: QULYHSMFLHKVQF-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3 |
|---|---|
| Molecular weight | 265.78 g/mol |
| IUPAC name | 3-tert-butyl-4-methyl-1-phenylpyrazol-5-amine;hydrochloride |
| InChIKey | QULYHSMFLHKVQF-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(C)(C)C)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)