CAS 317806-86-3 is the registry number for (1:1)3–tert–butyl–1–p–tolyl–1H–pyrazol–5–aMine. Offered by: GLPBio. Available pack sizes: 1g.
3-tert-butyl-1-(4-methylphenyl)pyrazol-5-amine;hydrochloride (CAS 317806-86-3) is a chemical compound with the molecular formula C14H20ClN3 and a molecular weight of 265.78 g/mol. IUPAC name: 3-tert-butyl-1-(4-methylphenyl)pyrazol-5-amine;hydrochloride. InChIKey: OKHVHZRMWCZFFO-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3 |
|---|---|
| Molecular weight | 265.78 g/mol |
| IUPAC name | 3-tert-butyl-1-(4-methylphenyl)pyrazol-5-amine;hydrochloride |
| InChIKey | OKHVHZRMWCZFFO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)