Products 1303968-43-5
CAS 1303968-43-5 appears in our catalog under these names: 3-Bromo-7H-furo(3,4-b)pyridin-5-one, 3-Bromo-7H-furo(3,4-b)pyridin-5-one, 97%. Offered by: TRC, AmBeed. Available pack sizes: 500mg, 1g, 250mg.
3-bromo-7H-furo[3,4-b]pyridin-5-one (CAS 1303968-43-5) is a chemical compound with the molecular formula C7H4BrNO2 and a molecular weight of 214.02 g/mol. IUPAC name: 3-bromo-7H-furo[3,4-b]pyridin-5-one. InChIKey: ROPDGXSXHXWJFZ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2 |
|---|---|
| Molecular weight | 214.02 g/mol |
| IUPAC name | 3-bromo-7H-furo[3,4-b]pyridin-5-one |
| InChIKey | ROPDGXSXHXWJFZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)Br)C(=O)O1 |
Computed by PubChem (NCBI)