CAS 1823373-30-3 is the registry number for 3-Bromofuro[3,4-b]pyridin-7(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5H-furo[3,4-b]pyridin-7-one (CAS 1823373-30-3) is a chemical compound with the molecular formula C7H4BrNO2 and a molecular weight of 214.02 g/mol. IUPAC name: 3-bromo-5H-furo[3,4-b]pyridin-7-one. InChIKey: PTZUMMHAOBZARG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2 |
|---|---|
| Molecular weight | 214.02 g/mol |
| IUPAC name | 3-bromo-5H-furo[3,4-b]pyridin-7-one |
| InChIKey | PTZUMMHAOBZARG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)O1)N=CC(=C2)Br |
Computed by PubChem (NCBI)