CAS 130403-91-7 appears in our catalog under these names: (S)-3-((tert-Butyldimethylsilyl)oxy)pyrrolidin-2-one, 95%, (S)–3–((tert–Butyldimethylsilyl)oxy)pyrrolidin–2–one. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one (CAS 130403-91-7) is a chemical compound with the molecular formula C10H21NO2Si and a molecular weight of 215.36 g/mol. IUPAC name: (3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one. InChIKey: QEJCHYKXNFQQSM-QMMMGPOBSA-N.
| Molecular formula | C10H21NO2Si |
|---|---|
| Molecular weight | 215.36 g/mol |
| IUPAC name | (3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one |
| InChIKey | QEJCHYKXNFQQSM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCNC1=O |
Computed by PubChem (NCBI)