CAS 131653-51-5 is the registry number for 2-Pyrrolidinone, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-, (4R)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one (CAS 131653-51-5) is a chemical compound with the molecular formula C10H21NO2Si and a molecular weight of 215.36 g/mol. IUPAC name: (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one. InChIKey: BEVGOGJIDJYUNN-MRVPVSSYSA-N.
| Molecular formula | C10H21NO2Si |
|---|---|
| Molecular weight | 215.36 g/mol |
| IUPAC name | (4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-one |
| InChIKey | BEVGOGJIDJYUNN-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)NC1 |
Computed by PubChem (NCBI)