CAS 1304266-32-7 appears in our catalog under these names: 2-{1-((4-oxo-3,4-dihydroquinazolin-2-yl)methyl)pyrrolidin-2-yl}acetic acid, 95%, 2-{1-((4-Oxo-3,4-dihydroquinazolin-2-yl)methyl)pyrrolidin-2-yl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[1-[(4-oxo-3H-quinazolin-2-yl)methyl]pyrrolidin-2-yl]acetic acid (CAS 1304266-32-7) is a chemical compound with the molecular formula C15H17N3O3 and a molecular weight of 287.31 g/mol. IUPAC name: 2-[1-[(4-oxo-3H-quinazolin-2-yl)methyl]pyrrolidin-2-yl]acetic acid. InChIKey: BLRNGQYUJMLDKN-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O3 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 2-[1-[(4-oxo-3H-quinazolin-2-yl)methyl]pyrrolidin-2-yl]acetic acid |
| InChIKey | BLRNGQYUJMLDKN-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)CC2=NC3=CC=CC=C3C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)