CAS 2570190-08-6 appears in our catalog under these names: 1-N-[(4-Methoxyphenyl)methyl]-2-N-methyl-4-nitrobenzene-1,2-diamine, 96%, N1-(4-Methoxybenzyl)-N2-methyl-4-nitrobenzene-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-N-[(4-methoxyphenyl)methyl]-2-N-methyl-4-nitrobenzene-1,2-diamine (CAS 2570190-08-6) is a chemical compound with the molecular formula C15H17N3O3 and a molecular weight of 287.31 g/mol. IUPAC name: 1-N-[(4-methoxyphenyl)methyl]-2-N-methyl-4-nitrobenzene-1,2-diamine. InChIKey: IREZDXLJHAVFRR-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O3 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 1-N-[(4-methoxyphenyl)methyl]-2-N-methyl-4-nitrobenzene-1,2-diamine |
| InChIKey | IREZDXLJHAVFRR-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)[N+](=O)[O-])NCC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)