Products 1304990-89-3
CAS 1304990-89-3 is the registry number for N-(2-Azidoethyl)-2-oxo-2H-1-benzopyran-3-carboxamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(2-azidoethyl)-2-oxochromene-3-carboxamide (CAS 1304990-89-3) is a chemical compound with the molecular formula C12H10N4O3 and a molecular weight of 258.23 g/mol. IUPAC name: N-(2-azidoethyl)-2-oxochromene-3-carboxamide. InChIKey: RMGSXCKHFMWJOZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O3 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | N-(2-azidoethyl)-2-oxochromene-3-carboxamide |
| InChIKey | RMGSXCKHFMWJOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)NCCN=[N+]=[N-] |
Computed by PubChem (NCBI)