Products 2925087-62-1
CAS 2925087-62-1 is the registry number for CRBN ligand-508. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carbaldehyde (CAS 2925087-62-1) is a chemical compound with the molecular formula C12H10N4O3 and a molecular weight of 258.23 g/mol. IUPAC name: 6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carbaldehyde. InChIKey: DDSSDRPZJKHLIQ-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O3 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carbaldehyde |
| InChIKey | DDSSDRPZJKHLIQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C3C=NNC3=C2)C=O |
Computed by PubChem (NCBI)