CAS 130506-22-8 appears in our catalog under these names: 6–Nitroso–1,2–benzopyrone, 6-Nitroso-2H-chromen-2-one, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg.
6-nitrosochromen-2-one (CAS 130506-22-8) is a chemical compound with the molecular formula C9H5NO3 and a molecular weight of 175.14 g/mol. IUPAC name: 6-nitrosochromen-2-one. InChIKey: HXTDAUGEZTYMGP-UHFFFAOYSA-N.
| Molecular formula | C9H5NO3 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 6-nitrosochromen-2-one |
| InChIKey | HXTDAUGEZTYMGP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1N=O |
Computed by PubChem (NCBI)