CAS 521-73-3 appears in our catalog under these names: Isoquinoline-1,3,4-trione, 95%, Isoquinoline–1,3,4(2H)–trione, Isoquinoline-1,3,4(2H)-trione 95%, 1,3,4(2H)-Isoquinolinetrione, 95%, 95%, Isoquinoline-1,3,4(2H)-trione, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
Isoquinoline-1,3,4-trione (CAS 521-73-3) is a chemical compound with the molecular formula C9H5NO3 and a molecular weight of 175.14 g/mol. IUPAC name: isoquinoline-1,3,4-trione. InChIKey: YIOFGHHAURBGSJ-UHFFFAOYSA-N.
| Molecular formula | C9H5NO3 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | isoquinoline-1,3,4-trione |
| InChIKey | YIOFGHHAURBGSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)NC2=O |
Computed by PubChem (NCBI)