Products 1305322-94-4
CAS 1305322-94-4 is the registry number for (S)-2-(4-Bromophenyl)-4-t-butyl-4,5-dihydrooxazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(4S)-2-(4-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole (CAS 1305322-94-4) is a chemical compound with the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. IUPAC name: (4S)-2-(4-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole. InChIKey: JLWQQWPXJJGMSW-LLVKDONJSA-N.
| Molecular formula | C13H16BrNO |
|---|---|
| Molecular weight | 282.18 g/mol |
| IUPAC name | (4S)-2-(4-bromophenyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| InChIKey | JLWQQWPXJJGMSW-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)