CAS 59507-55-0 is the registry number for N-Cyclohexyl 3-bromobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
3-bromo-N-cyclohexylbenzamide (CAS 59507-55-0) is a chemical compound with the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. IUPAC name: 3-bromo-N-cyclohexylbenzamide. InChIKey: VRUMXGVWUFXLAH-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO |
|---|---|
| Molecular weight | 282.18 g/mol |
| IUPAC name | 3-bromo-N-cyclohexylbenzamide |
| InChIKey | VRUMXGVWUFXLAH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)