CAS 1305324-53-1 is the registry number for 4-Bromo-2-(tert-butyl)oxazolo[4,5-c]pyridine-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid (CAS 1305324-53-1) is a chemical compound with the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. IUPAC name: 4-bromo-2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid. InChIKey: FVLPJXWLIMBZRO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O3 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 4-bromo-2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carboxylic acid |
| InChIKey | FVLPJXWLIMBZRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(O1)C(=CN=C2Br)C(=O)O |
Computed by PubChem (NCBI)