CAS 306935-28-4 is the registry number for 5-[(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 306935-28-4) is a chemical compound with the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. IUPAC name: 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: TXZIGOBIIZTCGA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O3 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | TXZIGOBIIZTCGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(O2)C(=O)O)C)Br |
Computed by PubChem (NCBI)