CAS 130540-87-3 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-phenylprop-2-yl methacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) 2-methylprop-2-enoate (CAS 130540-87-3) is a chemical compound with the molecular formula C13H10F6O2 and a molecular weight of 312.21 g/mol. IUPAC name: (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) 2-methylprop-2-enoate. InChIKey: SFYAZQDOFPKNOH-UHFFFAOYSA-N.
| Molecular formula | C13H10F6O2 |
|---|---|
| Molecular weight | 312.21 g/mol |
| IUPAC name | (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) 2-methylprop-2-enoate |
| InChIKey | SFYAZQDOFPKNOH-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC(C1=CC=CC=C1)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)