Products 286932-43-2
CAS 286932-43-2 is the registry number for 1,1,1,6,6,6-Hexafluoro-2-phenyl-5-methylhex-3-yne-2,5-diol. Offered by: Fluorochem. Available pack sizes: 1g.
1,1,1,6,6,6-hexafluoro-2-methyl-5-phenylhex-3-yne-2,5-diol (CAS 286932-43-2) is a chemical compound with the molecular formula C13H10F6O2 and a molecular weight of 312.21 g/mol. IUPAC name: 1,1,1,6,6,6-hexafluoro-2-methyl-5-phenylhex-3-yne-2,5-diol. InChIKey: CVXQUYAMFLGBFJ-UHFFFAOYSA-N.
| Molecular formula | C13H10F6O2 |
|---|---|
| Molecular weight | 312.21 g/mol |
| IUPAC name | 1,1,1,6,6,6-hexafluoro-2-methyl-5-phenylhex-3-yne-2,5-diol |
| InChIKey | CVXQUYAMFLGBFJ-UHFFFAOYSA-N |
| SMILES | CC(C#CC(C1=CC=CC=C1)(C(F)(F)F)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)