CAS 130564-37-3 appears in our catalog under these names: 1-(2-Methyl-2-nitropropyl)pyrrolidine, 95%, 1–(2–methyl–2–nitropropyl)pyrrolidine, 1-(2-methyl-2-nitropropyl)pyrrolidine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(2-methyl-2-nitropropyl)pyrrolidine (CAS 130564-37-3) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: 1-(2-methyl-2-nitropropyl)pyrrolidine. InChIKey: YBXUADBJRHSXIK-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 1-(2-methyl-2-nitropropyl)pyrrolidine |
| InChIKey | YBXUADBJRHSXIK-UHFFFAOYSA-N |
| SMILES | CC(C)(CN1CCCC1)[N+](=O)[O-] |
Computed by PubChem (NCBI)