CAS 130598-72-0 is the registry number for 6-Phenyl-1H-imidazo(1,2-b)pyrazole. Offered by: TRC. Available pack sizes: 250mg.
6-phenyl-5H-imidazo[1,2-b]pyrazole (CAS 130598-72-0) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 6-phenyl-5H-imidazo[1,2-b]pyrazole. InChIKey: NLYRPESMFJTOLW-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 6-phenyl-5H-imidazo[1,2-b]pyrazole |
| InChIKey | NLYRPESMFJTOLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=NC=CN3N2 |
Computed by PubChem (NCBI)