CAS 13065-93-5 appears in our catalog under these names: N1-(4-Chlorophenyl)benzene-1,4-diamine, 96%, N1–(4–Chlorophenyl)benzene–1,4–diamine, N1-(4-Chlorophenyl)benzene-1,4-diamine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-N-(4-chlorophenyl)benzene-1,4-diamine (CAS 13065-93-5) is a chemical compound with the molecular formula C12H11ClN2 and a molecular weight of 218.68 g/mol. IUPAC name: 4-N-(4-chlorophenyl)benzene-1,4-diamine. InChIKey: NLGIEISQJFZTIS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 4-N-(4-chlorophenyl)benzene-1,4-diamine |
| InChIKey | NLGIEISQJFZTIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)