CAS 83799-54-6 appears in our catalog under these names: 4-(Chloromethyl)-4'-methyl-2,2'-bipyridine, 95%, 4-(Chloromethyl)-4'-methyl-2,2'-bipyridyl, >97.0%(GC), 4-(Chloromethyl)-4'-methyl-2,2'-bipyridine 97% GC, 4-(Chloromethyl)-4'-methyl-2,2'-bipyridyl, 97%, 97%. Offered by: Combi-blocks, TCI, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g.
2-[4-(chloromethyl)-2-pyridinyl]-4-methylpyridine (CAS 83799-54-6) is a chemical compound with the molecular formula C12H11ClN2 and a molecular weight of 218.68 g/mol. IUPAC name: 2-[4-(chloromethyl)-2-pyridinyl]-4-methylpyridine. InChIKey: UHTKTJKJDJOOKE-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 2-[4-(chloromethyl)-2-pyridinyl]-4-methylpyridine |
| InChIKey | UHTKTJKJDJOOKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)CCl |
Computed by PubChem (NCBI)