Products 1306548-98-0
CAS 1306548-98-0 is the registry number for 3-(2-tert-Butyl-5-methylphenoxy)-2-(cyclopropylamino)-2-methylpropanenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-tert-butyl-5-methylphenoxy)-2-(cyclopropylamino)-2-methylpropanenitrile (CAS 1306548-98-0) is a chemical compound with the molecular formula C18H26N2O and a molecular weight of 286.4 g/mol. IUPAC name: 3-(2-tert-butyl-5-methylphenoxy)-2-(cyclopropylamino)-2-methylpropanenitrile. InChIKey: FVZBJSUKSHPOAN-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 3-(2-tert-butyl-5-methylphenoxy)-2-(cyclopropylamino)-2-methylpropanenitrile |
| InChIKey | FVZBJSUKSHPOAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)(C)C)OCC(C)(C#N)NC2CC2 |
Computed by PubChem (NCBI)