CAS 140924-11-4 is the registry number for AP-238. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2S,6R)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one (CAS 140924-11-4) is a chemical compound with the molecular formula C18H26N2O and a molecular weight of 286.4 g/mol. IUPAC name: 1-[(2S,6R)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one. InChIKey: JELNWDOXWGBBLO-QJBCGIKSSA-N.
| Molecular formula | C18H26N2O |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | 1-[(2S,6R)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]propan-1-one |
| InChIKey | JELNWDOXWGBBLO-QJBCGIKSSA-N |
| SMILES | CCC(=O)N1[C@@H](CN(C[C@@H]1C)C/C=C/C2=CC=CC=C2)C |
Computed by PubChem (NCBI)