CAS 1306604-62-5 appears in our catalog under these names: 1-(4-Methyl-1,3-thiazol-2-yl)cyclopentan-1-amine dihydrochloride, 95%, 1-(4-Methyl-1,3-thiazol-2-yl)cyclopentan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;dihydrochloride (CAS 1306604-62-5) is a chemical compound with the molecular formula C9H16Cl2N2S and a molecular weight of 255.21 g/mol. IUPAC name: 1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;dihydrochloride. InChIKey: QHBAEYDUPNTZTI-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2S |
|---|---|
| Molecular weight | 255.21 g/mol |
| IUPAC name | 1-(4-methyl-1,3-thiazol-2-yl)cyclopentan-1-amine;dihydrochloride |
| InChIKey | QHBAEYDUPNTZTI-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2(CCCC2)N.Cl.Cl |
Computed by PubChem (NCBI)