CAS 2361639-40-7 is the registry number for 1-(1,3-Thiazol-2-yl)cyclohexan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,3-thiazol-2-yl)cyclohexan-1-amine;dihydrochloride (CAS 2361639-40-7) is a chemical compound with the molecular formula C9H16Cl2N2S and a molecular weight of 255.21 g/mol. IUPAC name: 1-(1,3-thiazol-2-yl)cyclohexan-1-amine;dihydrochloride. InChIKey: OWGJZRSECWDCOO-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2S |
|---|---|
| Molecular weight | 255.21 g/mol |
| IUPAC name | 1-(1,3-thiazol-2-yl)cyclohexan-1-amine;dihydrochloride |
| InChIKey | OWGJZRSECWDCOO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=NC=CS2)N.Cl.Cl |
Computed by PubChem (NCBI)