CAS 1306606-56-3 appears in our catalog under these names: 2,2,2-Trifluoro-1-(trimethyl-1h-pyrazol-4-yl)ethan-1-one, 95%, 2,2,2-Trifluoro-1-(trimethyl-1H-pyrazol-4-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanone (CAS 1306606-56-3) is a chemical compound with the molecular formula C8H9F3N2O and a molecular weight of 206.16 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanone. InChIKey: ZIQGDXWRGNPXBL-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanone |
| InChIKey | ZIQGDXWRGNPXBL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)