CAS 1551521-44-8 is the registry number for 6-(3,3,3-Trifluoropropoxy)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(3,3,3-trifluoropropoxy)pyridin-2-amine (CAS 1551521-44-8) is a chemical compound with the molecular formula C8H9F3N2O and a molecular weight of 206.16 g/mol. IUPAC name: 6-(3,3,3-trifluoropropoxy)pyridin-2-amine. InChIKey: RZMZZKJVRWOJKW-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | 6-(3,3,3-trifluoropropoxy)pyridin-2-amine |
| InChIKey | RZMZZKJVRWOJKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCCC(F)(F)F)N |
Computed by PubChem (NCBI)