CAS 1306607-08-8 appears in our catalog under these names: 1-(5-Ethylfuran-2-yl)-2,2-dimethylpropan-1-amine, 95%, 1-(5-Ethylfuran-2-yl)-2,2-dimethylpropan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-amine (CAS 1306607-08-8) is a chemical compound with the molecular formula C11H19NO and a molecular weight of 181.27 g/mol. IUPAC name: 1-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-amine. InChIKey: AZMLQBSONUOIRS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO |
|---|---|
| Molecular weight | 181.27 g/mol |
| IUPAC name | 1-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-amine |
| InChIKey | AZMLQBSONUOIRS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(O1)C(C(C)(C)C)N |
Computed by PubChem (NCBI)